4-(Triethoxysilyl)pyridine structure
|
Common Name | 4-(Triethoxysilyl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 166262-04-0 | Molecular Weight | 241.359 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 259.8±13.0 °C at 760 mmHg | |
| Molecular Formula | C11H19NO3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.9±19.8 °C | |
| Name | triethoxy(pyridin-4-yl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 259.8±13.0 °C at 760 mmHg |
| Molecular Formula | C11H19NO3Si |
| Molecular Weight | 241.359 |
| Flash Point | 110.9±19.8 °C |
| Exact Mass | 241.113419 |
| PSA | 40.58000 |
| LogP | 1.50 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.474 |
| InChIKey | QTKVYJZLJBZISA-UHFFFAOYSA-N |
| SMILES | CCO[Si](OCC)(OCC)c1ccncc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(Triethoxysilyl)pyridine |
| 4-pyridyltriethoxysilane |
| Pyridine, 4-(triethoxysilyl)- |