(2-diazo-3-phenylpropyl)benzene structure
|
Common Name | (2-diazo-3-phenylpropyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 166264-26-2 | Molecular Weight | 222.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-diazo-3-phenylpropyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14N2 |
|---|---|
| Molecular Weight | 222.28500 |
| Exact Mass | 222.11600 |
| PSA | 37.39000 |
| LogP | 3.22366 |
| InChIKey | LITPELIOTFCRQT-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=C(Cc1ccccc1)Cc1ccccc1 |
|
~98%
(2-diazo-3-phen... CAS#:166264-26-2 |
| Literature: Holton, Terrence L.; Shechter, Harold Journal of Organic Chemistry, 1995 , vol. 60, # 15 p. 4725 - 4729 |
|
~%
(2-diazo-3-phen... CAS#:166264-26-2 |
| Literature: Holton, Terrence L.; Shechter, Harold Journal of Organic Chemistry, 1995 , vol. 60, # 15 p. 4725 - 4729 |
| Benzene,1,1'-(2-diazo-1,3-propanediyl)bis |
| 2-Diazo-1,3-diphenylpropane |