4''-O-(4-Hydroxycinnaamoyl)afzelin
Modify Date: 2026-07-17 18:08:11
4''-O-(4-Hydroxycinnaamoyl)afzelin structure
|
Common Name | 4''-O-(4-Hydroxycinnaamoyl)afzelin | ||
|---|---|---|---|---|
| CAS Number | 166321-98-8 | Molecular Weight | 578.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H26O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4''-O-(4-Hydroxycinnaamoyl)afzelin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C30H26O12 |
|---|---|
| Molecular Weight | 578.5 |
| InChIKey | RFTKNPGPPJOOBI-NTWDEFLTSA-N |
| SMILES | CC1OC(Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)C(O)C(O)C1OC(=O)C=Cc1ccc(O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4''-O-(4-Hydroxycinnaamoyl)afzelin? |
| A: SMILES notation of 4''-O-(4-Hydroxycinnaamoyl)afzelin is CC1OC(Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)C(O)C(O)C1OC(=O)C=Cc1ccc(O)cc1. |
| Q: What is the Chinese name of 166321-98-8? |
| A: Chinese name of 166321-98-8 is 166321-98-8. |
| Q: What is the InChIKey of 4''-O-(4-Hydroxycinnaamoyl)afzelin? |
| A: InChIKey of 4''-O-(4-Hydroxycinnaamoyl)afzelin is RFTKNPGPPJOOBI-NTWDEFLTSA-N. |
| Q: What is the CAS number of 4''-O-(4-Hydroxycinnaamoyl)afzelin? |
| A: CAS number of 4''-O-(4-Hydroxycinnaamoyl)afzelin is 166321-98-8. |
| Q: What is the molecular formula of 4''-O-(4-Hydroxycinnaamoyl)afzelin? |
| A: Molecular formula of 4''-O-(4-Hydroxycinnaamoyl)afzelin is C30H26O12. |
| Q: What is the molecular weight of 4''-O-(4-Hydroxycinnaamoyl)afzelin? |
| A: Molecular weight of 4''-O-(4-Hydroxycinnaamoyl)afzelin is 578.5. |
| Q: What is the English name of 4''-O-(4-Hydroxycinnaamoyl)afzelin? |
| A: The English name of 4''-O-(4-Hydroxycinnaamoyl)afzelin is 4''-O-(4-Hydroxycinnaamoyl)afzelin. |