3'',4''-Di-O-p-coumaroylafzelin
Modify Date: 2026-08-14 17:20:11
3'',4''-Di-O-p-coumaroylafzelin structure
|
Common Name | 3'',4''-Di-O-p-coumaroylafzelin | ||
|---|---|---|---|---|
| CAS Number | 166321-99-9 | Molecular Weight | 724.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H32O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3'',4''-Di-O-p-coumaroylafzelin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C39H32O14 |
|---|---|
| Molecular Weight | 724.7 |
| InChIKey | RMHWAEFAOBGGBH-GLRBGJJXSA-N |
| SMILES | CC1OC(Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)C(O)C(OC(=O)C=Cc2ccc(O)cc2)C1OC(=O)C=Cc1ccc(O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 166321-99-9? |
| A: Chinese name of 166321-99-9 is 166321-99-9. |
| Q: What is the CAS number of 3'',4''-Di-O-p-coumaroylafzelin? |
| A: CAS number of 3'',4''-Di-O-p-coumaroylafzelin is 166321-99-9. |
| Q: What is the molecular formula of 3'',4''-Di-O-p-coumaroylafzelin? |
| A: Molecular formula of 3'',4''-Di-O-p-coumaroylafzelin is C39H32O14. |
| Q: What is the molecular weight of 3'',4''-Di-O-p-coumaroylafzelin? |
| A: Molecular weight of 3'',4''-Di-O-p-coumaroylafzelin is 724.7. |
| Q: What is the English name of 3'',4''-Di-O-p-coumaroylafzelin? |
| A: The English name of 3'',4''-Di-O-p-coumaroylafzelin is 3'',4''-Di-O-p-coumaroylafzelin. |
| Q: What is the InChIKey of 3'',4''-Di-O-p-coumaroylafzelin? |
| A: InChIKey of 3'',4''-Di-O-p-coumaroylafzelin is RMHWAEFAOBGGBH-GLRBGJJXSA-N. |
| Q: What is the SMILES notation of 3'',4''-Di-O-p-coumaroylafzelin? |
| A: SMILES notation of 3'',4''-Di-O-p-coumaroylafzelin is CC1OC(Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)C(O)C(OC(=O)C=Cc2ccc(O)cc2)C1OC(=O)C=Cc1ccc(O)cc1. |