Descarboxyl orbifloxacin structure
|
Common Name | Descarboxyl orbifloxacin | ||
|---|---|---|---|---|
| CAS Number | 166323-26-8 | Molecular Weight | 351.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20F3N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Descarboxyl orbifloxacin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H20F3N3O |
|---|---|
| Molecular Weight | 351.4 |
| InChIKey | ZHUACHFPOGNNKF-AOOOYVTPSA-N |
| SMILES | CC1CN(c2c(F)c(F)c3c(=O)ccn(C4CC4)c3c2F)CC(C)N1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 166323-26-8? |
| A: Chinese name of 166323-26-8 is 166323-26-8. |
| Q: What is the InChIKey of Descarboxyl orbifloxacin? |
| A: InChIKey of Descarboxyl orbifloxacin is ZHUACHFPOGNNKF-AOOOYVTPSA-N. |
| Q: What is the molecular formula of Descarboxyl orbifloxacin? |
| A: Molecular formula of Descarboxyl orbifloxacin is C18H20F3N3O. |
| Q: What is the CAS number of Descarboxyl orbifloxacin? |
| A: CAS number of Descarboxyl orbifloxacin is 166323-26-8. |
| Q: What is the molecular weight of Descarboxyl orbifloxacin? |
| A: Molecular weight of Descarboxyl orbifloxacin is 351.4. |
| Q: What is the SMILES notation of Descarboxyl orbifloxacin? |
| A: SMILES notation of Descarboxyl orbifloxacin is CC1CN(c2c(F)c(F)c3c(=O)ccn(C4CC4)c3c2F)CC(C)N1. |
| Q: What is the English name of Descarboxyl orbifloxacin? |
| A: The English name of Descarboxyl orbifloxacin is Descarboxyl orbifloxacin. |