4,4,5,5-Tetramethyl-2-[(triphenylmethoxy)methyl]-1,3,2-dioxaborolane
Modify Date: 2025-09-23 13:01:19
![4,4,5,5-Tetramethyl-2-[(triphenylmethoxy)methyl]-1,3,2-dioxaborolane Structure](https://www.chemsrc.com/extcaspic/180/166330-04-7.png)
4,4,5,5-Tetramethyl-2-[(triphenylmethoxy)methyl]-1,3,2-dioxaborolane structure
|
Common Name | 4,4,5,5-Tetramethyl-2-[(triphenylmethoxy)methyl]-1,3,2-dioxaborolane | ||
|---|---|---|---|---|
| CAS Number | 166330-04-7 | Molecular Weight | 400.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H29BO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4,5,5-Tetramethyl-2-[(triphenylmethoxy)methyl]-1,3,2-dioxaborolane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H29BO3 |
|---|---|
| Molecular Weight | 400.3 |
| InChIKey | DMFBPXPWIIBJNB-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(COC(c2ccccc2)(c2ccccc2)c2ccccc2)OC1(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4,4,5,5-Tetramethyl-2-[(triphenylmethoxy)methyl]-1,3,2-dioxaborolane? |
| A: CAS number of 4,4,5,5-Tetramethyl-2-[(triphenylmethoxy)methyl]-1,3,2-dioxaborolane is 166330-04-7. |
| Q: What is the InChIKey of 4,4,5,5-Tetramethyl-2-[(triphenylmethoxy)methyl]-1,3,2-dioxaborolane? |
| A: InChIKey of 4,4,5,5-Tetramethyl-2-[(triphenylmethoxy)methyl]-1,3,2-dioxaborolane is DMFBPXPWIIBJNB-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 166330-04-7? |
| A: Chinese name of 166330-04-7 is 166330-04-7. |
| Q: What is the SMILES notation of 4,4,5,5-Tetramethyl-2-[(triphenylmethoxy)methyl]-1,3,2-dioxaborolane? |
| A: SMILES notation of 4,4,5,5-Tetramethyl-2-[(triphenylmethoxy)methyl]-1,3,2-dioxaborolane is CC1(C)OB(COC(c2ccccc2)(c2ccccc2)c2ccccc2)OC1(C)C. |
| Q: What is the molecular formula of 4,4,5,5-Tetramethyl-2-[(triphenylmethoxy)methyl]-1,3,2-dioxaborolane? |
| A: Molecular formula of 4,4,5,5-Tetramethyl-2-[(triphenylmethoxy)methyl]-1,3,2-dioxaborolane is C26H29BO3. |
| Q: What is the molecular weight of 4,4,5,5-Tetramethyl-2-[(triphenylmethoxy)methyl]-1,3,2-dioxaborolane? |
| A: Molecular weight of 4,4,5,5-Tetramethyl-2-[(triphenylmethoxy)methyl]-1,3,2-dioxaborolane is 400.3. |
| Q: What is the English name of 4,4,5,5-Tetramethyl-2-[(triphenylmethoxy)methyl]-1,3,2-dioxaborolane? |
| A: The English name of 4,4,5,5-Tetramethyl-2-[(triphenylmethoxy)methyl]-1,3,2-dioxaborolane is 4,4,5,5-Tetramethyl-2-[(triphenylmethoxy)methyl]-1,3,2-dioxaborolane. |