di-tert-butylzinc structure
|
Common Name | di-tert-butylzinc | ||
|---|---|---|---|---|
| CAS Number | 16636-96-7 | Molecular Weight | 179.60900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H18Zn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | zinc,2-methylpropane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H18Zn |
|---|---|
| Molecular Weight | 179.60900 |
| Exact Mass | 178.07000 |
| LogP | 3.23870 |
| InChIKey | BYYXHWABFVUKLO-UHFFFAOYSA-N |
| SMILES | C[C-](C)C.C[C-](C)C.[Zn+2] |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Zinc,bis(1,1-dimethylethyl) |
| Di-tert-butylzinc |
| bis(tert-butyl)zinc |