N,S-Dicarbethoxy-L-cysteine
Modify Date: 2025-09-03 14:18:30
N,S-Dicarbethoxy-L-cysteine structure
|
Common Name | N,S-Dicarbethoxy-L-cysteine | ||
|---|---|---|---|---|
| CAS Number | 16639-88-6 | Molecular Weight | 265.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H15NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,S-Dicarbethoxy-L-cysteine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H15NO6S |
|---|---|
| Molecular Weight | 265.29 |
| InChIKey | PDRBOYPLXHFIDU-LURJTMIESA-N |
| SMILES | CCOC(=O)NC(CSC(=O)OCC)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N,S-Dicarbethoxy-L-cysteine? |
| A: The English name of N,S-Dicarbethoxy-L-cysteine is N,S-Dicarbethoxy-L-cysteine. |
| Q: What is the molecular formula of N,S-Dicarbethoxy-L-cysteine? |
| A: Molecular formula of N,S-Dicarbethoxy-L-cysteine is C9H15NO6S. |
| Q: What is the SMILES notation of N,S-Dicarbethoxy-L-cysteine? |
| A: SMILES notation of N,S-Dicarbethoxy-L-cysteine is CCOC(=O)NC(CSC(=O)OCC)C(=O)O. |
| Q: What is the CAS number of N,S-Dicarbethoxy-L-cysteine? |
| A: CAS number of N,S-Dicarbethoxy-L-cysteine is 16639-88-6. |
| Q: What is the molecular weight of N,S-Dicarbethoxy-L-cysteine? |
| A: Molecular weight of N,S-Dicarbethoxy-L-cysteine is 265.29. |
| Q: What is the InChIKey of N,S-Dicarbethoxy-L-cysteine? |
| A: InChIKey of N,S-Dicarbethoxy-L-cysteine is PDRBOYPLXHFIDU-LURJTMIESA-N. |
| Q: What is the Chinese name of 16639-88-6? |
| A: Chinese name of 16639-88-6 is 16639-88-6. |