Tenofovir diphosphate structure
|
Common Name | Tenofovir diphosphate | ||
|---|---|---|---|---|
| CAS Number | 166403-66-3 | Molecular Weight | 447.17200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H16N5O10P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tenofovir diphosphateTenofovir diphosphate (TFV-DP) is a competitive DNA polymerases inhibitor (with respect to dATP) and a substrate of HIV type 1 (HIV-1) reverse transcriptase (RT)[1]. |
| Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Tenofovir diphosphate (TFV-DP) is a competitive DNA polymerases inhibitor (with respect to dATP) and a substrate of HIV type 1 (HIV-1) reverse transcriptase (RT)[1]. |
|---|---|
| Related Catalog | |
| Target |
DNA polymerases; HIV-1 reverse transcriptase[1] |
| In Vitro | Tenofovir diphosphate acts as an inhibitor of DNA pol. Tenofovir-diphosphate is a weak inhibitor of DNA polymerases (pol) α, δ, and ɛ, with values for the Ki for PMPApp (PMPAppKi) relative to the Km for dATP (dATPKm) of 10.2, 10.2, and 15.6, respectively[1]. |
| References |
| Molecular Formula | C9H16N5O10P3 |
|---|---|
| Molecular Weight | 447.17200 |
| Exact Mass | 447.01100 |
| PSA | 258.87000 |
| LogP | 0.76400 |
| InChIKey | IACQCQDWSIQSRP-ZCFIWIBFSA-N |
| SMILES | CC(Cn1cnc2c(N)ncnc21)OCP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| tenofovir diphosphate |
| TNV |
| PMPApp |
| PMPA diphosphate |
| TFVTP |
| Tenofovir-DP |
| [2-(6-AMINO-9H-PURIN-9-YL)-1-METHYLETHOXY]METHYL-TRIPHOSPHATE |