1-Methyl-β-carboline-3-carboxylic acid methyl ester structure
|
Common Name | 1-Methyl-β-carboline-3-carboxylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 16641-82-0 | Molecular Weight | 240.25700 | |
| Density | 1.431g/cm3 | Boiling Point | 520.3ºC at 760 mmHg | |
| Molecular Formula | C14H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.5ºC | |
| Name | methyl 1-methyl-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.431g/cm3 |
|---|---|
| Boiling Point | 520.3ºC at 760 mmHg |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.25700 |
| Flash Point | 268.5ºC |
| Exact Mass | 240.09000 |
| PSA | 54.98000 |
| LogP | 2.81110 |
| Vapour Pressure | 1.19E-11mmHg at 25°C |
| Index of Refraction | 1.778 |
| InChIKey | LIAUJQLOCLVMMH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2c([nH]c3ccccc32)c(C)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9H-Pyrido[3,4-b]indole-3-carboxylic acid,1-methyl-,methyl ester |
| 1-Methyl-9H-pyrido(3,4-b)indole-3-carboxylic acid methyl ester |
| S 437 |