5Acetamido-2carboxy-4-dimethylamino-2-hydroxybenzophenone structure
|
Common Name | 5Acetamido-2carboxy-4-dimethylamino-2-hydroxybenzophenone | ||
|---|---|---|---|---|
| CAS Number | 166442-37-1 | Molecular Weight | 342.34600 | |
| Density | 1.371g/cm3 | Boiling Point | 655.4ºC at 760 mmHg | |
| Molecular Formula | C18H18N2O5 | Melting Point | 228-229ºC dec. | |
| MSDS | N/A | Flash Point | 350.1ºC | |
| Name | 4-acetamido-2-[4-(dimethylamino)-2-hydroxybenzoyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.371g/cm3 |
|---|---|
| Boiling Point | 655.4ºC at 760 mmHg |
| Melting Point | 228-229ºC dec. |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.34600 |
| Flash Point | 350.1ºC |
| Exact Mass | 342.12200 |
| PSA | 106.94000 |
| LogP | 2.41880 |
| Vapour Pressure | 4.55E-18mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | WCNJYYOJSXOYND-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(=O)O)c(C(=O)c2ccc(N(C)C)cc2O)c1 |
|
~%
5Acetamido-2car... CAS#:166442-37-1 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , # 20 p. 2967 - 2974 |
|
~%
5Acetamido-2car... CAS#:166442-37-1 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , # 20 p. 2967 - 2974 |
|
~%
5Acetamido-2car... CAS#:166442-37-1 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , # 20 p. 2967 - 2974 |
|
~%
5Acetamido-2car... CAS#:166442-37-1 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , # 20 p. 2967 - 2974 |
| 5'-acetamido-2'-carboxy-4-dimethylamino-2-hydroxybenzophenone |