N-Ethoxycarbonyl-3-nitro-p-toluidine structure
|
Common Name | N-Ethoxycarbonyl-3-nitro-p-toluidine | ||
|---|---|---|---|---|
| CAS Number | 16648-53-6 | Molecular Weight | 224.21300 | |
| Density | 1.292g/cm3 | Boiling Point | 287.7ºC at 760 mmHg | |
| Molecular Formula | C10H12N2O4 | Melting Point | 80ºC | |
| MSDS | N/A | Flash Point | 127.8ºC | |
| Name | ethyl N-(4-methyl-3-nitrophenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 287.7ºC at 760 mmHg |
| Melting Point | 80ºC |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.21300 |
| Flash Point | 127.8ºC |
| Exact Mass | 224.08000 |
| PSA | 84.15000 |
| LogP | 3.06780 |
| Vapour Pressure | 0.00244mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | ZSEVLTABICCPPU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1ccc(C)c([N+](=O)[O-])c1 |
| HS Code | 2924299090 |
|---|
|
~%
N-Ethoxycarbony... CAS#:16648-53-6 |
| Literature: Bulletin de la Societe Chimique de France, , vol. <3>21, p. 588 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ethyl 3-nitro-4-methylphenylcarbamate |
| N-Ethoxycarbonyl-3-nitro-p-toluidine |
| N-Carbethoxy-3-nitro-p-toluidine |
| Ethyl 4-Methyl-3-nitrophenylcarbamate |