phytocassane D
Modify Date: 2025-11-06 15:16:46
phytocassane D structure
|
Common Name | phytocassane D | ||
|---|---|---|---|---|
| CAS Number | 166547-24-6 | Molecular Weight | 316.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H28O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | phytocassane D |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H28O3 |
|---|---|
| Molecular Weight | 316.4 |
| InChIKey | DGUIKAVSMBLZCL-MKSLXUROSA-N |
| SMILES | C=CC1=CC(=O)C2C(CCC3C(C)(C)C(O)C(=O)CC23C)C1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of phytocassane D? |
| A: CAS number of phytocassane D is 166547-24-6. |
| Q: What is the molecular weight of phytocassane D? |
| A: Molecular weight of phytocassane D is 316.4. |
| Q: What is the English name of phytocassane D? |
| A: The English name of phytocassane D is phytocassane D. |
| Q: What is the SMILES notation of phytocassane D? |
| A: SMILES notation of phytocassane D is C=CC1=CC(=O)C2C(CCC3C(C)(C)C(O)C(=O)CC23C)C1C. |
| Q: What is the InChIKey of phytocassane D? |
| A: InChIKey of phytocassane D is DGUIKAVSMBLZCL-MKSLXUROSA-N. |
| Q: What is the Chinese name of 166547-24-6? |
| A: Chinese name of 166547-24-6 is 166547-24-6. |
| Q: What is the molecular formula of phytocassane D? |
| A: Molecular formula of phytocassane D is C20H28O3. |