JWH-198 structure
|
Common Name | JWH-198 | ||
|---|---|---|---|---|
| CAS Number | 166599-76-4 | Molecular Weight | 414.496 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 635.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C26H26N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 338.2±31.5 °C | |
Use of JWH-198JWH 198 is a synthetic cannabinoid (CB) which binds the central CB1 receptor with high affinity (Ki = 10 nM). This aminoalkylindole shares structural features with the antinociceptive CB1 agonists pravadoline and WIN 55,212-2.1 The physiological and toxicological properties of this compound have not been investigated. This product is intended for research and forensic applications. |
| Name | (4-methoxynaphthalen-1-yl)-[1-(2-morpholin-4-ylethyl)indol-3-yl]methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 635.6±55.0 °C at 760 mmHg |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.496 |
| Flash Point | 338.2±31.5 °C |
| Exact Mass | 414.194336 |
| PSA | 43.70000 |
| LogP | 4.39 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | QWHSUXWDDKWTOG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2cn(CCN3CCOCC3)c3ccccc23)c2ccccc12 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| JWH-198 |
| (4-Methoxy-1-naphthyl){1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl}methanone |
| Methanone, (4-methoxy-1-naphthalenyl)[1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl]- |
| (4-methoxynaphthalen-1-yl){1-[2-(morpholin-4-yl)ethyl]-1H-indol-3-yl}methanone |