4-Cyclohexene-1,2-dicarboxylic acid, 4-methyl-, (1R,2R)-(-)- (8CI)
Modify Date: 2025-08-27 19:28:58
4-Cyclohexene-1,2-dicarboxylic acid, 4-methyl-, (1R,2R)-(-)- (8CI) structure
|
Common Name | 4-Cyclohexene-1,2-dicarboxylic acid, 4-methyl-, (1R,2R)-(-)- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 16665-71-7 | Molecular Weight | 184.18900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1R,2R)-4-methylcyclohex-4-ene-1,2-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H12O4 |
|---|---|
| Molecular Weight | 184.18900 |
| Exact Mass | 184.07400 |
| PSA | 74.60000 |
| LogP | 1.12810 |
| InChIKey | YZPUIHVHPSUCHD-RNFRBKRXSA-N |
| SMILES | CC1=CCC(C(=O)O)C(C(=O)O)C1 |
| HS Code | 2917209090 |
|---|
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 4-Methyl-trans-4-cyclohexen-1,2-dicarbonsaeure |
| 4-Cyclohexene-1,2-dicarboxylicacid,4-methyl-,(1R,2R)-(-)-(8CI) |
| (+-)-trans-4-methyl-cyclohex-4-ene-1,2-dicarboxylic acid |
| trans-4,6-Methylcyclohex-4-endicarbonsaeure |
| 4-Cyclohexene-1,2-dicarboxylicacid,4-methyl-,(1R,2R) |
| (+/-)-trans-4-Methyl-cyclohex-4-en-1,2-dicarbonsaeure |