AURORA 14488 structure
|
Common Name | AURORA 14488 | ||
|---|---|---|---|---|
| CAS Number | 166751-33-3 | Molecular Weight | 247.31600 | |
| Density | 1.33g/cm3 | Boiling Point | 410ºC at 760 mmHg | |
| Molecular Formula | C12H13N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.8ºC | |
| Name | 6-amino-2-[(2-methylphenyl)methylsulfanyl]-1H-pyrimidin-4-one |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 410ºC at 760 mmHg |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.31600 |
| Flash Point | 201.8ºC |
| Exact Mass | 247.07800 |
| PSA | 97.07000 |
| LogP | 2.53400 |
| Vapour Pressure | 6.2E-07mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | JCGSUAADGPAKEI-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1CSc1nc(N)cc(=O)[nH]1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |