6-Chloro-2-[(3,4-difluorobenzyl)thio]pyrimidin-4-amine
Modify Date: 2026-06-26 19:27:49
![6-Chloro-2-[(3,4-difluorobenzyl)thio]pyrimidin-4-amine Structure](https://www.chemsrc.com/extcaspic/435/166751-75-3.png)
6-Chloro-2-[(3,4-difluorobenzyl)thio]pyrimidin-4-amine structure
|
Common Name | 6-Chloro-2-[(3,4-difluorobenzyl)thio]pyrimidin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 166751-75-3 | Molecular Weight | 287.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8ClF2N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Chloro-2-[(3,4-difluorobenzyl)thio]pyrimidin-4-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8ClF2N3S |
|---|---|
| Molecular Weight | 287.72 |
| InChIKey | VZGUZRMROMVEIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CSC2=NC(=CC(=N2)Cl)N)F)F |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 6-Chloro-2-[(3,4-difluorobenzyl)thio]pyrimidin-4-amine? |
| A: InChIKey of 6-Chloro-2-[(3,4-difluorobenzyl)thio]pyrimidin-4-amine is VZGUZRMROMVEIV-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 6-Chloro-2-[(3,4-difluorobenzyl)thio]pyrimidin-4-amine? |
| A: SMILES notation of 6-Chloro-2-[(3,4-difluorobenzyl)thio]pyrimidin-4-amine is C1=CC(=C(C=C1CSC2=NC(=CC(=N2)Cl)N)F)F. |
| Q: What is the molecular weight of 6-Chloro-2-[(3,4-difluorobenzyl)thio]pyrimidin-4-amine? |
| A: Molecular weight of 6-Chloro-2-[(3,4-difluorobenzyl)thio]pyrimidin-4-amine is 287.72. |
| Q: What is the Chinese name of 166751-75-3? |
| A: Chinese name of 166751-75-3 is 166751-75-3. |
| Q: What is the molecular formula of 6-Chloro-2-[(3,4-difluorobenzyl)thio]pyrimidin-4-amine? |
| A: Molecular formula of 6-Chloro-2-[(3,4-difluorobenzyl)thio]pyrimidin-4-amine is C11H8ClF2N3S. |
| Q: What is the English name of 6-Chloro-2-[(3,4-difluorobenzyl)thio]pyrimidin-4-amine? |
| A: The English name of 6-Chloro-2-[(3,4-difluorobenzyl)thio]pyrimidin-4-amine is 6-Chloro-2-[(3,4-difluorobenzyl)thio]pyrimidin-4-amine. |
| Q: What is the CAS number of 6-Chloro-2-[(3,4-difluorobenzyl)thio]pyrimidin-4-amine? |
| A: CAS number of 6-Chloro-2-[(3,4-difluorobenzyl)thio]pyrimidin-4-amine is 166751-75-3. |