10,11-Dihydro-10-[2-(dimethylamino)ethyl]-8-methoxy-5H-dibenzo[b,e][1,4]diazepin-11-one structure
|
Common Name | 10,11-Dihydro-10-[2-(dimethylamino)ethyl]-8-methoxy-5H-dibenzo[b,e][1,4]diazepin-11-one | ||
|---|---|---|---|---|
| CAS Number | 1668-66-2 | Molecular Weight | 311.37800 | |
| Density | 1.156g/cm3 | Boiling Point | 502.6ºC at 760mmHg | |
| Molecular Formula | C18H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.8ºC | |
| Name | 5-[2-(dimethylamino)ethyl]-3-methoxy-11H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.156g/cm3 |
|---|---|
| Boiling Point | 502.6ºC at 760mmHg |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.37800 |
| Flash Point | 257.8ºC |
| Exact Mass | 311.16300 |
| PSA | 50.26000 |
| LogP | 2.61520 |
| Vapour Pressure | 3.13E-10mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | ZELWYXSIOKOBDF-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)N(CCN(C)C)C(=O)c1ccccc1N2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 10,11-Dihydro-11-oxo-5H-dibenzo(b,e)(1,4)diazepine,10-(2-(dimethylamino)ethyl)-8-methoxy |
| 10-(2-dimethylamino-ethyl)-8-methoxy-5,10-dihydro-dibenzo[b,e][1,4]diazepin-11-one |
| 5H-Dibenzo(b,e)(1,4)diazepin-11-one,10,11-dihydro-10-(2-(dimethylamino)ethyl)-8-methoxy |
| 5-(2-dimethylaminoethyl)-3-methoxy-11H-benzo[b][1,4]benzodiazepin-6-one |