Cyclo(-Glu-Glu) structure
|
Common Name | Cyclo(-Glu-Glu) | ||
|---|---|---|---|---|
| CAS Number | 16691-00-2 | Molecular Weight | 258.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cyclo(-Glu-Glu)Cyclo(-Glu-Glu) is a cyclic peptide, a cyclic structure formed by linking two glutamic acid residues through a peptide bond[1]. |
| Name | 3-[(2S,5S)-5-(2-carboxyethyl)-3,6-dioxopiperazin-2-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Cyclo(-Glu-Glu) is a cyclic peptide, a cyclic structure formed by linking two glutamic acid residues through a peptide bond[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C10H14N2O6 |
|---|---|
| Molecular Weight | 258.23 |
| Exact Mass | 258.08500 |
| PSA | 132.80000 |
| InChIKey | NDCKGUDRHBPJAQ-WDSKDSINSA-N |
| SMILES | O=C(O)CCC1NC(=O)C(CCC(=O)O)NC1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| L-glutamic acid dimer |
| 2,5-Piperazinedipropanoicacid,3,6-dioxo-,(2S,5S) |
| 3,3'-[(2S)-(3,6-dioxo-piperazine-2r,5c-diyl)-di-propionic acid |
| cyclo(L-Glu-L-Glu) |
| 2,5-Piperazinedipropanoicacid,3,6-dioxo-,(2S-cis) |
| cyclo-(glutamyl-glutamyl) |
| 2,5-Piperazinedipropionic acid,3,6-dioxo-,(2S,5S)-(8CI) |
| diketopiperazine of L-glutamic acid |
| cyclo-(Glu-Glu) |
| Cyclo(-Glu-Glu) |