N-methyl-N-tosylacetamide
N-methyl-N-tosylacetamide structure
|
Common Name | N-methyl-N-tosylacetamide | ||
|---|---|---|---|---|
| CAS Number | 16697-83-9 | Molecular Weight | 227.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-methyl-N-tosylacetamide (Chinese name: N-甲基-N-对甲苯磺基乙酰胺, CAS number: 16697-83-9, molecular formula: C10H13NO3S, molecular weight: 227.28000), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-methyl-N-tosylacetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13NO3S |
|---|---|
| Molecular Weight | 227.28000 |
| Exact Mass | 227.06200 |
| PSA | 62.83000 |
| LogP | 2.24280 |
| InChIKey | KXWKSNSAIXBORI-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C)S(=O)(=O)c1ccc(C)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Discovery of Small Molecules to Inhibit Human Cytomegalovirus Nuclear Egress
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: HCMV UL50
External Id: HMS1262
|
|
Name: A screen for compounds that inhibit the activity of LtaS in Staphylococcus aureus
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
External Id: HMS979
|
|
Name: A screen for compounds that inhibit viral RNA polymerase binding and polymerization a...
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: Chain A, Poliovirus Polymerase With Gtp
External Id: HMS750
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| acetyl-methyl-(toluene-4-sulfonyl)-amine |
| Acetyl-methyl-(toluol-4-sulfonyl)-amin |
| N-Acetyl-N-methyl-p-toluolsulfonamid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does N-methyl-N-tosylacetamide have? |
| A: English synonyms of N-methyl-N-tosylacetamide: acetyl-methyl-(toluene-4-sulfonyl)-amine, Acetyl-methyl-(toluol-4-sulfonyl)-amin, N-Acetyl-N-methyl-p-toluolsulfonamid. |
| Q: What is the English name of N-methyl-N-tosylacetamide? |
| A: The English name of N-methyl-N-tosylacetamide is N-methyl-N-tosylacetamide. |
| Q: What is the Chinese name of 16697-83-9? |
| A: Chinese name of 16697-83-9 is 16697-83-9. |
| Q: What is the molecular weight of N-methyl-N-tosylacetamide? |
| A: Molecular weight of N-methyl-N-tosylacetamide is 227.28000. |
| Q: What is the SMILES notation of N-methyl-N-tosylacetamide? |
| A: SMILES notation of N-methyl-N-tosylacetamide is CC(=O)N(C)S(=O)(=O)c1ccc(C)cc1. |
| Q: What is the LogP of N-methyl-N-tosylacetamide? |
| A: LogP of N-methyl-N-tosylacetamide is 2.24280. |
| Q: What is the InChIKey of N-methyl-N-tosylacetamide? |
| A: InChIKey of N-methyl-N-tosylacetamide is KXWKSNSAIXBORI-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of N-methyl-N-tosylacetamide? |
| A: Polar surface area (PSA) of N-methyl-N-tosylacetamide is 62.83000. |
| Q: What is the molecular formula of N-methyl-N-tosylacetamide? |
| A: Molecular formula of N-methyl-N-tosylacetamide is C10H13NO3S. |
| Q: What is the CAS number of N-methyl-N-tosylacetamide? |
| A: CAS number of N-methyl-N-tosylacetamide is 16697-83-9. |