4,4-Dimethyl-7-ethynyl-1-tetralone structure
|
Common Name | 4,4-Dimethyl-7-ethynyl-1-tetralone | ||
|---|---|---|---|---|
| CAS Number | 166978-48-9 | Molecular Weight | 198.26000 | |
| Density | 1.07±0.1 g/cm3(Predicted) | Boiling Point | 316.7±41.0 °C(Predicted) | |
| Molecular Formula | C14H14O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-ethynyl-4,4-dimethyl-2,3-dihydronaphthalen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 316.7±41.0 °C(Predicted) |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26000 |
| Exact Mass | 198.10400 |
| PSA | 17.07000 |
| LogP | 2.92200 |
| InChIKey | FSENXSHCDBCKEZ-UHFFFAOYSA-N |
| SMILES | C#Cc1ccc2c(c1)C(=O)CCC2(C)C |
|
~%
4,4-Dimethyl-7-... CAS#:166978-48-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 38, # 24 p. 4764 - 4767 |
|
~%
Detail
|
| Literature: US5489584 A1, ; |
|
~%
4,4-Dimethyl-7-... CAS#:166978-48-9 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 9, # 4 p. 573 - 576 |
|
~%
4,4-Dimethyl-7-... CAS#:166978-48-9 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 9, # 4 p. 573 - 576 |
| 7-ethynyl-3,4-dihydro-4,4-dimethylnaphthalen-1(2H)-one |
| 4,4-DIMETHYL-7-ETHYNYL-1-TETRALONE |