Benzene,1-chloro-2-[1-(4-chlorophenyl)-2-iodoethyl]-
Modify Date: 2025-08-26 16:44:58
![Benzene,1-chloro-2-[1-(4-chlorophenyl)-2-iodoethyl]- Structure](https://image.chemsrc.com/caspic/348/16699-33-5.png)
Benzene,1-chloro-2-[1-(4-chlorophenyl)-2-iodoethyl]- structure
|
Common Name | Benzene,1-chloro-2-[1-(4-chlorophenyl)-2-iodoethyl]- | ||
|---|---|---|---|---|
| CAS Number | 16699-33-5 | Molecular Weight | 377.04800 | |
| Density | 1.647g/cm3 | Boiling Point | 394.2ºC at 760mmHg | |
| Molecular Formula | C14H11Cl2I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.2ºC | |
| Name | 1-chloro-2-(2-piperazinylethoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.647g/cm3 |
|---|---|
| Boiling Point | 394.2ºC at 760mmHg |
| Molecular Formula | C14H11Cl2I |
| Molecular Weight | 377.04800 |
| Flash Point | 192.2ºC |
| Exact Mass | 375.92800 |
| LogP | 5.56030 |
| Vapour Pressure | 4.59E-06mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | RBOZOSFDVBTWFD-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C(CI)c2ccccc2Cl)cc1 |
|
~%
Benzene,1-chlor... CAS#:16699-33-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 11, p. 380 - 382 |
![1-chloro-2-[1-(4-chlorophenyl)-2-(4-methylphenyl)sulfonyloxy-ethyl]benzene structure](https://image.chemsrc.com/caspic/423/18164-53-9.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-(o-Chlor-phenyl)-1-(p-chlor-phenyl)-2-iod-aethan |
| 1-[2-(2-Chloro-phenoxy)-ethyl]-piperazine |
| 1-(o-Chlorphenoxyethyl)piperazin |