Benzene,1-chloro-2-[1-(4-chlorophenyl)-2-iodoethyl]
![Benzene,1-chloro-2-[1-(4-chlorophenyl)-2-iodoethyl] Structure](https://image.chemsrc.com/caspic/348/16699-33-5.png)
Benzene,1-chloro-2-[1-(4-chlorophenyl)-2-iodoethyl] structure
|
Common Name | Benzene,1-chloro-2-[1-(4-chlorophenyl)-2-iodoethyl] | ||
|---|---|---|---|---|
| CAS Number | 16699-33-5 | Molecular Weight | 377.04800 | |
| Density | 1.647g/cm3 | Boiling Point | 394.2ºC at 760mmHg | |
| Molecular Formula | C14H11Cl2I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-chloro-2-(2-piperazinylethoxy)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.647g/cm3 |
|---|---|
| Boiling Point | 394.2ºC at 760mmHg |
| Molecular Formula | C14H11Cl2I |
| Molecular Weight | 377.04800 |
| Flash Point | 192.2ºC |
| Exact Mass | 375.92800 |
| LogP | 5.56030 |
| Vapour Pressure | 4.59E-06mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | RBOZOSFDVBTWFD-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C(CI)c2ccccc2Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Benzene,1-chlor... CAS#:16699-33-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 11, p. 380 - 382 |
![1-chloro-2-[1-(4-chlorophenyl)-2-(4-methylphenyl)sulfonyloxy-ethyl]benzene structure](https://image.chemsrc.com/caspic/423/18164-53-9.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-(o-Chlor-phenyl)-1-(p-chlor-phenyl)-2-iod-aethan |
| 1-[2-(2-Chloro-phenoxy)-ethyl]-piperazine |
| 1-(o-Chlorphenoxyethyl)piperazin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-chloro-2-(2-piperazinylethoxy)benzene? |
| A: Molecular weight of 1-chloro-2-(2-piperazinylethoxy)benzene is 377.04800. |
| Q: What is the Chinese name of 16699-33-5? |
| A: Chinese name of 16699-33-5 is 16699-33-5. |
| Q: What is the molecular formula of 1-chloro-2-(2-piperazinylethoxy)benzene? |
| A: Molecular formula of 1-chloro-2-(2-piperazinylethoxy)benzene is C14H11Cl2I. |
| Q: What is the LogP of 1-chloro-2-(2-piperazinylethoxy)benzene? |
| A: LogP of 1-chloro-2-(2-piperazinylethoxy)benzene is 5.56030. |
| Q: What English synonyms does 1-chloro-2-(2-piperazinylethoxy)benzene have? |
| A: English synonyms of 1-chloro-2-(2-piperazinylethoxy)benzene: 1-(o-Chlor-phenyl)-1-(p-chlor-phenyl)-2-iod-aethan, 1-[2-(2-Chloro-phenoxy)-ethyl]-piperazine, 1-(o-Chlorphenoxyethyl)piperazin. |
| Q: What is the InChIKey of 1-chloro-2-(2-piperazinylethoxy)benzene? |
| A: InChIKey of 1-chloro-2-(2-piperazinylethoxy)benzene is RBOZOSFDVBTWFD-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-chloro-2-(2-piperazinylethoxy)benzene? |
| A: CAS number of 1-chloro-2-(2-piperazinylethoxy)benzene is 16699-33-5. |
| Q: What is the SMILES notation of 1-chloro-2-(2-piperazinylethoxy)benzene? |
| A: SMILES notation of 1-chloro-2-(2-piperazinylethoxy)benzene is Clc1ccc(C(CI)c2ccccc2Cl)cc1. |
| Q: What is the boiling point of 1-chloro-2-(2-piperazinylethoxy)benzene? |
| A: Boiling point of 1-chloro-2-(2-piperazinylethoxy)benzene is 394.2ºC at 760mmHg. |
| Q: What is the English name of 1-chloro-2-(2-piperazinylethoxy)benzene? |
| A: The English name of 1-chloro-2-(2-piperazinylethoxy)benzene is 1-chloro-2-(2-piperazinylethoxy)benzene. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |