[3-(4-tert-butylbenzoyl)phenyl]-(4-tert-butylphenyl)methanone structure
|
Common Name | [3-(4-tert-butylbenzoyl)phenyl]-(4-tert-butylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 167014-18-8 | Molecular Weight | 398.53700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3-(4-tert-butylbenzoyl)phenyl]-(4-tert-butylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C28H30O2 |
|---|---|
| Molecular Weight | 398.53700 |
| Exact Mass | 398.22500 |
| PSA | 34.14000 |
| LogP | 6.74360 |
| InChIKey | KVSZLPWSCWMYLG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)c2cccc(C(=O)c3ccc(C(C)(C)C)cc3)c2)cc1 |
|
~73%
[3-(4-tert-buty... CAS#:167014-18-8 |
| Literature: Wienk, Martijn M.; Janssen, Rene A. J. Journal of the American Chemical Society, 1997 , vol. 119, # 23 p. 5398 - 5403 |
| Methanone,1,3-phenylenebis[[4-(1,1-dimethylethyl)phenyl] |
| 4-tert-butyl-3-(4''-tert-butylbenzoyl)benzophenone |