Kadsurindutin E
Modify Date: 2026-07-26 20:37:47
Kadsurindutin E structure
|
Common Name | Kadsurindutin E | ||
|---|---|---|---|---|
| CAS Number | 1670237-95-2 | Molecular Weight | 344.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Kadsurindutin E |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H24O5 |
|---|---|
| Molecular Weight | 344.4 |
| InChIKey | XZJPAPVOQRSAFU-UHFFFAOYSA-N |
| SMILES | COc1cc(CC(C)C(C)Cc2ccc3c(c2)OCO3)cc(O)c1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Kadsurindutin E? |
| A: CAS number of Kadsurindutin E is 1670237-95-2. |
| Q: What is the Chinese name of 1670237-95-2? |
| A: Chinese name of 1670237-95-2 is 1670237-95-2. |
| Q: What is the molecular formula of Kadsurindutin E? |
| A: Molecular formula of Kadsurindutin E is C20H24O5. |
| Q: What is the InChIKey of Kadsurindutin E? |
| A: InChIKey of Kadsurindutin E is XZJPAPVOQRSAFU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Kadsurindutin E? |
| A: Molecular weight of Kadsurindutin E is 344.4. |
| Q: What is the SMILES notation of Kadsurindutin E? |
| A: SMILES notation of Kadsurindutin E is COc1cc(CC(C)C(C)Cc2ccc3c(c2)OCO3)cc(O)c1O. |
| Q: What is the English name of Kadsurindutin E? |
| A: The English name of Kadsurindutin E is Kadsurindutin E. |