(S)-2-(2-((4,4,4-Trifluorobutyl)sulfonyl)ethyl)pyrrolidine
Modify Date: 2026-07-06 21:01:55
(S)-2-(2-((4,4,4-Trifluorobutyl)sulfonyl)ethyl)pyrrolidine structure
|
Common Name | (S)-2-(2-((4,4,4-Trifluorobutyl)sulfonyl)ethyl)pyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 1670272-83-9 | Molecular Weight | 273.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18F3NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-2-(2-((4,4,4-Trifluorobutyl)sulfonyl)ethyl)pyrrolidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H18F3NO2S |
|---|---|
| Molecular Weight | 273.32 |
| InChIKey | DFGHWGZOYRVFCM-VIFPVBQESA-N |
| SMILES | O=S(=O)(CCCC(F)(F)F)CCC1CCCN1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (S)-2-(2-((4,4,4-Trifluorobutyl)sulfonyl)ethyl)pyrrolidine? |
| A: Molecular weight of (S)-2-(2-((4,4,4-Trifluorobutyl)sulfonyl)ethyl)pyrrolidine is 273.32. |
| Q: What is the SMILES notation of (S)-2-(2-((4,4,4-Trifluorobutyl)sulfonyl)ethyl)pyrrolidine? |
| A: SMILES notation of (S)-2-(2-((4,4,4-Trifluorobutyl)sulfonyl)ethyl)pyrrolidine is O=S(=O)(CCCC(F)(F)F)CCC1CCCN1. |
| Q: What is the English name of (S)-2-(2-((4,4,4-Trifluorobutyl)sulfonyl)ethyl)pyrrolidine? |
| A: The English name of (S)-2-(2-((4,4,4-Trifluorobutyl)sulfonyl)ethyl)pyrrolidine is (S)-2-(2-((4,4,4-Trifluorobutyl)sulfonyl)ethyl)pyrrolidine. |
| Q: What is the CAS number of (S)-2-(2-((4,4,4-Trifluorobutyl)sulfonyl)ethyl)pyrrolidine? |
| A: CAS number of (S)-2-(2-((4,4,4-Trifluorobutyl)sulfonyl)ethyl)pyrrolidine is 1670272-83-9. |
| Q: What is the Chinese name of 1670272-83-9? |
| A: Chinese name of 1670272-83-9 is 1670272-83-9. |
| Q: What is the molecular formula of (S)-2-(2-((4,4,4-Trifluorobutyl)sulfonyl)ethyl)pyrrolidine? |
| A: Molecular formula of (S)-2-(2-((4,4,4-Trifluorobutyl)sulfonyl)ethyl)pyrrolidine is C10H18F3NO2S. |
| Q: What is the InChIKey of (S)-2-(2-((4,4,4-Trifluorobutyl)sulfonyl)ethyl)pyrrolidine? |
| A: InChIKey of (S)-2-(2-((4,4,4-Trifluorobutyl)sulfonyl)ethyl)pyrrolidine is DFGHWGZOYRVFCM-VIFPVBQESA-N. |