Phosphonic acid,(4-methoxybenzoyl)-, diethyl ester structure
|
Common Name | Phosphonic acid,(4-methoxybenzoyl)-, diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 16703-95-0 | Molecular Weight | 272.23400 | |
| Density | 1.176g/cm3 | Boiling Point | 365.7ºC at 760mmHg | |
| Molecular Formula | C12H17O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.6ºC | |
| Name | diethoxyphosphoryl-(4-methoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.176g/cm3 |
|---|---|
| Boiling Point | 365.7ºC at 760mmHg |
| Molecular Formula | C12H17O5P |
| Molecular Weight | 272.23400 |
| Flash Point | 188.6ºC |
| Exact Mass | 272.08100 |
| PSA | 71.64000 |
| LogP | 3.10150 |
| Vapour Pressure | 1.54E-05mmHg at 25°C |
| Index of Refraction | 1.492 |
| InChIKey | SDVRDVLYLCQGPF-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)C(=O)c1ccc(OC)cc1 |
|
~94%
Phosphonic acid... CAS#:16703-95-0 |
| Literature: Synthetic Communications, , vol. 34, # 8 p. 1463 - 1471 |
|
~71%
Phosphonic acid... CAS#:16703-95-0 |
| Literature: Journal of the American Chemical Society, , vol. 116, # 3 p. 1016 - 1026 |
|
~%
Phosphonic acid... CAS#:16703-95-0 |
| Literature: Tetrahedron Letters, , vol. 41, # 17 p. 3169 - 3171 |
| p-methoxybenzoyldiethylphosphonate |