Uridine, 6-methyl- structure
|
Common Name | Uridine, 6-methyl- | ||
|---|---|---|---|---|
| CAS Number | 16710-13-7 | Molecular Weight | 258.23 | |
| Density | 1.576g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Uridine, 6-methyl-6-Methyluridine is a uridine analogue. Uridine has potential antiepileptic effects, and its analogs can be used to study anticonvulsant and anxiolytic activities, as well as to develop new antihypertensive agents[1]. |
| Name | 6-Methyluridine |
|---|---|
| Synonym | More Synonyms |
| Description | 6-Methyluridine is a uridine analogue. Uridine has potential antiepileptic effects, and its analogs can be used to study anticonvulsant and anxiolytic activities, as well as to develop new antihypertensive agents[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.576g/cm3 |
|---|---|
| Molecular Formula | C10H14N2O6 |
| Molecular Weight | 258.23 |
| Exact Mass | 258.08500 |
| PSA | 124.78000 |
| Index of Refraction | 1.618 |
| InChIKey | SGKGZYGMLGVQHP-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)[nH]c(=O)n1C1OC(CO)C(O)C1O |
| sulfanilic acid-[4]pyridylamide |
| 5-Methyluridine |
| 6-Methyl-uridin |
| 4-amino-N-pyridin-4-yl-benzenesulfonamide |
| N1-4-pyridylsulfanilamide |
| 4-p-aminobenzenesulphonamidopyridine |
| Sulfanilsaeure-[4]pyridylamid |
| N1-6-methyluridine |
| 6-methyl uridine |