1,2,3,6-tetrahydro-1,3-dimethyl-2,6-dioxo-7H-purine-7-propanesulphonic acid structure
|
Common Name | 1,2,3,6-tetrahydro-1,3-dimethyl-2,6-dioxo-7H-purine-7-propanesulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 1672-28-2 | Molecular Weight | 302.30700 | |
| Density | 1.64g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14N4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propane-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Molecular Formula | C10H14N4O5S |
| Molecular Weight | 302.30700 |
| Exact Mass | 302.06800 |
| PSA | 124.57000 |
| Index of Refraction | 1.69 |
| InChIKey | RSTSVFVCHWLPHQ-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(ncn2CCCS(=O)(=O)O)n(C)c1=O |
| HS Code | 2933990090 |
|---|
|
~80%
1,2,3,6-tetrahy... CAS#:1672-28-2 |
| Literature: Kondo, Koichi; Aoi, Hidemichi; Takemoto, Kiichi Synthetic Communications, 1980 , vol. 10, # 4 p. 267 - 272 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-(3'-sulfopropyl)theophylline |
| 7h-purine-7-propanesulfonic acid,1,2,3,6-tetrahydro-1,3-dimethyl-2,6-dioxo |
| 7-(3-Sulfo-propyl)-theophyllin |
| 3-(1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-purin-7-yl)-propane-1-sulfonic acid |
| 1,2,3,6-tetrahydro-1,3-dimethyl-2,6-dioxo-7H-purine-7-propanesulfonic acid |
| EINECS 216-805-7 |
| 1,2,3,6-Tetrahydro-1,3-dimethyl-2,6-dioxo-7H-purine-7-propanesulphonic acid |