2-Furancarboxylicacid, 5-nitro-, 2-(aminothioxomethyl)hydrazide structure
|
Common Name | 2-Furancarboxylicacid, 5-nitro-, 2-(aminothioxomethyl)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 1673-59-2 | Molecular Weight | 230.20100 | |
| Density | 1.622g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H6N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(5-nitrofuran-2-carbonyl)amino]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.622g/cm3 |
|---|---|
| Molecular Formula | C6H6N4O4S |
| Molecular Weight | 230.20100 |
| Exact Mass | 230.01100 |
| PSA | 158.20000 |
| LogP | 1.67110 |
| Index of Refraction | 1.672 |
| InChIKey | BWNXARABTNBSQF-UHFFFAOYSA-N |
| SMILES | NC(=S)NNC(=O)c1ccc([N+](=O)[O-])o1 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|
| 5-nitro-2-furancarboxylic acid |