ethyl 4-ethenylbenzenesulfonate
Modify Date: 2025-10-02 20:41:26
ethyl 4-ethenylbenzenesulfonate structure
|
Common Name | ethyl 4-ethenylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 16736-98-4 | Molecular Weight | 212.26500 | |
| Density | 1.179g/cm3 | Boiling Point | 325.4ºC at 760 mmHg | |
| Molecular Formula | C10H12O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.6ºC | |
| Name | ethyl 4-ethenylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.179g/cm3 |
|---|---|
| Boiling Point | 325.4ºC at 760 mmHg |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.26500 |
| Flash Point | 150.6ºC |
| Exact Mass | 212.05100 |
| PSA | 51.75000 |
| LogP | 3.13560 |
| Vapour Pressure | 0.000439mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | YAUZJFRMTBUCGL-UHFFFAOYSA-N |
| SMILES | C=Cc1ccc(S(=O)(=O)OCC)cc1 |
|
~68%
ethyl 4-ethenyl... CAS#:16736-98-4 |
| Literature: Journal of Polymer Science, Part A: Polymer Chemistry, , vol. 49, # 18 p. 3960 - 3969 |
| Benzenesulfonic acid,4-ethenyl-,ethyl ester |
| 4-styrenesulfonate ethyl ester |
| p-Vinyl-benzolsulfonsaeure-aethylester |
| p-styrenesulfonate ethyl ester |