Sulfo-EGS Crosslinker structure
|
Common Name | Sulfo-EGS Crosslinker | ||
|---|---|---|---|---|
| CAS Number | 167410-92-6 | Molecular Weight | 652.51500 | |
| Density | 1.85 | Boiling Point | N/A | |
| Molecular Formula | C18H24N2O20S2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of Sulfo-EGS CrosslinkerSulfo-EGS Crosslinker, or Ethylene glycol bis(sulfosuccinimidylsuccinate), is a water soluble homobifunctional crosslinker. Sulfo-EGS Crosslinker can be used to label cell surface proteins as the molecule is not cell membrane permeable. |
| Name | 2-(2,5-dioxopyrrolidin-1-yl)-2-sulfobutanedioic acid,ethane-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.85 |
|---|---|
| Molecular Formula | C18H24N2O20S2 |
| Molecular Weight | 652.51500 |
| Exact Mass | 652.03600 |
| PSA | 389.92000 |
| InChIKey | YDFAYDGRSWSLCT-UHFFFAOYSA-N |
| SMILES | O=C(CCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)OCCOC(=O)CCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O |
| ethylene glycol bis(sulfosuccinimidyl succinate) |
| Butanoic acid,4-[(2,5-dioxo-3-sulfo-1-pyrrolidinyl)oxy]-4-oxo-,1,1'-(1,2-ethanediyl) ester |