[3-bromo-5-(propan-2-yloxy)-1H-1,2,4-triazol-1-yl]acetic acid
Modify Date: 2026-07-31 04:32:06
![[3-bromo-5-(propan-2-yloxy)-1H-1,2,4-triazol-1-yl]acetic acid Structure](https://www.chemsrc.com/extcaspic/482/1674389-80-0.png)
[3-bromo-5-(propan-2-yloxy)-1H-1,2,4-triazol-1-yl]acetic acid structure
|
Common Name | [3-bromo-5-(propan-2-yloxy)-1H-1,2,4-triazol-1-yl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 1674389-80-0 | Molecular Weight | 264.08 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H10BrN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [3-bromo-5-(propan-2-yloxy)-1H-1,2,4-triazol-1-yl]acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H10BrN3O3 |
|---|---|
| Molecular Weight | 264.08 |
| InChIKey | RBHVNAXMHHACTB-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1nc(Br)nn1CC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of [3-bromo-5-(propan-2-yloxy)-1H-1,2,4-triazol-1-yl]acetic acid? |
| A: Molecular formula of [3-bromo-5-(propan-2-yloxy)-1H-1,2,4-triazol-1-yl]acetic acid is C7H10BrN3O3. |
| Q: What is the Chinese name of 1674389-80-0? |
| A: Chinese name of 1674389-80-0 is 1674389-80-0. |
| Q: What is the CAS number of [3-bromo-5-(propan-2-yloxy)-1H-1,2,4-triazol-1-yl]acetic acid? |
| A: CAS number of [3-bromo-5-(propan-2-yloxy)-1H-1,2,4-triazol-1-yl]acetic acid is 1674389-80-0. |
| Q: What is the molecular weight of [3-bromo-5-(propan-2-yloxy)-1H-1,2,4-triazol-1-yl]acetic acid? |
| A: Molecular weight of [3-bromo-5-(propan-2-yloxy)-1H-1,2,4-triazol-1-yl]acetic acid is 264.08. |
| Q: What is the InChIKey of [3-bromo-5-(propan-2-yloxy)-1H-1,2,4-triazol-1-yl]acetic acid? |
| A: InChIKey of [3-bromo-5-(propan-2-yloxy)-1H-1,2,4-triazol-1-yl]acetic acid is RBHVNAXMHHACTB-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of [3-bromo-5-(propan-2-yloxy)-1H-1,2,4-triazol-1-yl]acetic acid? |
| A: SMILES notation of [3-bromo-5-(propan-2-yloxy)-1H-1,2,4-triazol-1-yl]acetic acid is CC(C)Oc1nc(Br)nn1CC(=O)O. |
| Q: What is the English name of [3-bromo-5-(propan-2-yloxy)-1H-1,2,4-triazol-1-yl]acetic acid? |
| A: The English name of [3-bromo-5-(propan-2-yloxy)-1H-1,2,4-triazol-1-yl]acetic acid is [3-bromo-5-(propan-2-yloxy)-1H-1,2,4-triazol-1-yl]acetic acid. |