methyl 1,5-dimethyl-1H-indole-2-carboxylate
Modify Date: 2025-10-11 15:43:12
methyl 1,5-dimethyl-1H-indole-2-carboxylate structure
|
Common Name | methyl 1,5-dimethyl-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 167478-82-2 | Molecular Weight | 203.24 | |
| Density | 1.12±0.1 g/cm3(Predicted) | Boiling Point | 339.4±22.0 °C(Predicted) | |
| Molecular Formula | C12H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 1,5-dimethyl-1H-indole-2-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.12±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 339.4±22.0 °C(Predicted) |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 |
| InChIKey | XCLVWEJWFCVZCT-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2cc(C)ccc2n1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of methyl 1,5-dimethyl-1H-indole-2-carboxylate? |
| A: CAS number of methyl 1,5-dimethyl-1H-indole-2-carboxylate is 167478-82-2. |
| Q: What is the molecular weight of methyl 1,5-dimethyl-1H-indole-2-carboxylate? |
| A: Molecular weight of methyl 1,5-dimethyl-1H-indole-2-carboxylate is 203.24. |
| Q: What is the InChIKey of methyl 1,5-dimethyl-1H-indole-2-carboxylate? |
| A: InChIKey of methyl 1,5-dimethyl-1H-indole-2-carboxylate is XCLVWEJWFCVZCT-UHFFFAOYSA-N. |
| Q: What is the molecular formula of methyl 1,5-dimethyl-1H-indole-2-carboxylate? |
| A: Molecular formula of methyl 1,5-dimethyl-1H-indole-2-carboxylate is C12H13NO2. |
| Q: What is the boiling point of methyl 1,5-dimethyl-1H-indole-2-carboxylate? |
| A: Boiling point of methyl 1,5-dimethyl-1H-indole-2-carboxylate is 339.4±22.0 °C(Predicted). |
| Q: What is the SMILES notation of methyl 1,5-dimethyl-1H-indole-2-carboxylate? |
| A: SMILES notation of methyl 1,5-dimethyl-1H-indole-2-carboxylate is COC(=O)c1cc2cc(C)ccc2n1C. |
| Q: What is the English name of methyl 1,5-dimethyl-1H-indole-2-carboxylate? |
| A: The English name of methyl 1,5-dimethyl-1H-indole-2-carboxylate is methyl 1,5-dimethyl-1H-indole-2-carboxylate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |