naphthalene-1,5-disulphonic acid, compound with S-[2-(diethylamino)ethyl] diphenyldithiocarbamate (1:2) structure
|
Common Name | naphthalene-1,5-disulphonic acid, compound with S-[2-(diethylamino)ethyl] diphenyldithiocarbamate (1:2) | ||
|---|---|---|---|---|
| CAS Number | 1675-05-4 | Molecular Weight | 977.37100 | |
| Density | N/A | Boiling Point | 450ºC at 760 mmHg | |
| Molecular Formula | C48H56N4O6S6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.9ºC | |
| Name | 2-(diethylamino)ethyl N,N-diphenylcarbamodithioate,naphthalene-1,5-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 450ºC at 760 mmHg |
|---|---|
| Molecular Formula | C48H56N4O6S6 |
| Molecular Weight | 977.37100 |
| Flash Point | 225.9ºC |
| Exact Mass | 976.25200 |
| PSA | 253.24000 |
| LogP | 13.86400 |
| Vapour Pressure | 2.74E-08mmHg at 25°C |
| InChIKey | UEFKJUIPCKDPLK-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCSC(=S)N(c1ccccc1)c1ccccc1.CCN(CC)CCSC(=S)N(c1ccccc1)c1ccccc1.O=S(=O)(O)c1cccc2c(S(=O)(=O)O)cccc12 |
| EINECS 216-820-9 |
| 2-diethylaminoethyl N,N-diphenylcarbamodithioate |