Hydrazinecarboxamide,2-[1-methyl-3-(4-methylphenyl)-2-propen-1-ylidene]- structure
|
Common Name | Hydrazinecarboxamide,2-[1-methyl-3-(4-methylphenyl)-2-propen-1-ylidene]- | ||
|---|---|---|---|---|
| CAS Number | 16759-33-4 | Molecular Weight | 217.26700 | |
| Density | 1.09g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(E)-[(E)-4-(4-methylphenyl)but-3-en-2-ylidene]amino]urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.26700 |
| Exact Mass | 217.12200 |
| PSA | 67.48000 |
| LogP | 3.14360 |
| Index of Refraction | 1.554 |
| InChIKey | WSUKPCLIPVWORY-HNTZWPLZSA-N |
| SMILES | CC(C=Cc1ccc(C)cc1)=NNC(N)=O |
|
~%
Hydrazinecarbox... CAS#:16759-33-4 |
| Literature: Dimmock; Smith; Brenner; et al. European Journal of Medicinal Chemistry, 1986 , vol. 21, # 3 p. 187 - 192 |
|
~%
Hydrazinecarbox... CAS#:16759-33-4 |
| Literature: Dimmock; Smith; Brenner; et al. European Journal of Medicinal Chemistry, 1986 , vol. 21, # 3 p. 187 - 192 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-p-Tolyl-but-3-en-2-on-semicarbazon |
| 4-p-tolyl-but-3-en-2-one semicarbazone |