Benoxafos structure
|
Common Name | Benoxafos | ||
|---|---|---|---|---|
| CAS Number | 16759-59-4 | Molecular Weight | 386.25400 | |
| Density | 1.46g/cm3 | Boiling Point | 443.7ºC at 760mmHg | |
| Molecular Formula | C12H14Cl2NO3PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.1ºC | |
Use of BenoxafosBenoxafos is an insecticide. |
| Name | benoxafos |
|---|---|
| Synonym | More Synonyms |
| Description | Benoxafos is an insecticide. |
|---|---|
| Related Catalog |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 443.7ºC at 760mmHg |
| Molecular Formula | C12H14Cl2NO3PS2 |
| Molecular Weight | 386.25400 |
| Flash Point | 222.1ºC |
| Exact Mass | 384.95300 |
| PSA | 111.69000 |
| LogP | 6.31590 |
| Vapour Pressure | 1.19E-07mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | KEZAYQGUTKCBLO-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)SCc1nc2cc(Cl)cc(Cl)c2o1 |
| Storage condition | 2-8℃ |
| Benoxafosum |
| Benoxafos |
| UNII-LF2DT5DL6H |
| S-[(5,7-dichloro-1,3-benzoxazol-2-yl)methyl] O,O-diethyl phosphorodithioate |
| Benoxafos [INN] |
| S-5,7-dichloro-1,3-benzoxazol-2-ylmethyl O,O-diethyl phosphorodithioate |
| S-[(5,7-dichloro-2-benzoxazolyl)methyl] O,O-diethyl phosphorodithioate |
| HOE 2910 |
| Benoxafosum [INN-Latin] |
| (5,7-dichloro-1,3-benzoxazol-2-yl)methylsulfanyl-diethoxy-sulfanylidene-λ<sup>5</sup>-phosphane |
| S-[(5,7-Dichloro-2-benzoxazolyl)methyl] O,O-diethyl phosphorodithioate |