Terpendole I structure
|
Common Name | Terpendole I | ||
|---|---|---|---|---|
| CAS Number | 167612-17-1 | Molecular Weight | 453.570 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 668.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C27H35NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 358.0±31.5 °C | |
Use of Terpendole ITerpendole I, a fungal indoloditerpene, is a ACAT (acyl-CoA: cholesterol acyltransferase) inhibitor (IC50=145 µM)[1]. |
| Name | Terpendole I |
|---|---|
| Synonym | More Synonyms |
| Description | Terpendole I, a fungal indoloditerpene, is a ACAT (acyl-CoA: cholesterol acyltransferase) inhibitor (IC50=145 µM)[1]. |
|---|---|
| Related Catalog | |
| Target |
Microbial Metabolite |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 668.4±55.0 °C at 760 mmHg |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.570 |
| Flash Point | 358.0±31.5 °C |
| Exact Mass | 453.251526 |
| LogP | 4.51 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | AKOANWZRKXOJTC-ZWNZASDISA-N |
| SMILES | CC(C)(O)C1OC2CCC3(C)C4(C)c5[nH]c6ccccc6c5CC4CCC3(O)C23OC3C1O |
| 2H,4bH-Oxireno[4',4a']-1-benzopyrano[5',6':6,7]indeno[1,2-b]indole-3,4b-diol, 3,3a,5,6,6a,7,12,12b,12c,13,14,14a-dodecahydro-2-(1-hydroxy-1-methylethyl)-12b,12c-dimethyl-, (2S,3R,3aR,4aS,4bS,6aS,12bS,12cR,14aS)- |
| Terpendole I |
| (2S,3R,3aR,4aS,4bS,6aS,12bS,12cR,14aS)-2-(2-Hydroxy-2-propanyl)-12b,12c-dimethyl-3,3a,5,6,6a,7,12,12b,12c,13,14,14a-dodecahydro-2H,4bH-oxireno[4',4a']chromeno[5',6':6,7]indeno[1,2-b]indole-3,4b-diol |