Methyl 3-(1H-1,2,4-triazol-1-yl)benzoate structure
|
Common Name | Methyl 3-(1H-1,2,4-triazol-1-yl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 167626-27-9 | Molecular Weight | 203.19700 | |
| Density | 1.272g/cm3 | Boiling Point | 382.161ºC at 760 mmHg | |
| Molecular Formula | C10H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.925ºC | |
| Name | methyl 3-(1,2,4-triazol-1-yl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 382.161ºC at 760 mmHg |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.19700 |
| Flash Point | 184.925ºC |
| Exact Mass | 203.06900 |
| PSA | 57.01000 |
| LogP | 1.05390 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | NKGYSGGAEUCELQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(-n2cncn2)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 3-(1h-1,2,4-triazol-1-yl)benzoate |