5-hydroxy-isopththalic acid monomethyl ester structure
|
Common Name | 5-hydroxy-isopththalic acid monomethyl ester | ||
|---|---|---|---|---|
| CAS Number | 167630-15-1 | Molecular Weight | 196.15700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-hydroxy-5-methoxycarbonylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H8O5 |
|---|---|
| Molecular Weight | 196.15700 |
| Exact Mass | 196.03700 |
| PSA | 83.83000 |
| LogP | 0.87700 |
| InChIKey | GWUUUIMPMKEIAZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(O)cc(C(=O)O)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-hydroxy-isopththalic acid monomethyl ester |
| 3-Hydroxy-5-(methoxycarbonyl)benzoic acid |
| 5-hydroxyisophthalic acid monomethyl ester |