Fmoc-trans-4-Amc-OH structure
|
Common Name | Fmoc-trans-4-Amc-OH | ||
|---|---|---|---|---|
| CAS Number | 167690-53-1 | Molecular Weight | 379.44900 | |
| Density | 1.226 g/cm3 | Boiling Point | 604.9ºC at 760 mmHg | |
| Molecular Formula | C23H25NO4 | Melting Point | 188 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | fmoc-tranexamic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226 g/cm3 |
|---|---|
| Boiling Point | 604.9ºC at 760 mmHg |
| Melting Point | 188 °C |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.44900 |
| Exact Mass | 379.17800 |
| PSA | 75.63000 |
| LogP | 4.80700 |
| InChIKey | MLMIBGARTUSGND-UHFFFAOYSA-N |
| SMILES | O=C(NCC1CCC(C(=O)O)CC1)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Fmoc-trans-4-aminomethylcyclohexanecarboxylic acid |