Rifamycin,4-O-[2-[bis(2-methylpropyl)amino]-2-oxoethyl]- (9CI) structure
|
Common Name | Rifamycin,4-O-[2-[bis(2-methylpropyl)amino]-2-oxoethyl]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 16784-05-7 | Molecular Weight | 867.03300 | |
| Density | 1.26g/cm3 | Boiling Point | 945ºC at 760mmHg | |
| Molecular Formula | C47H66N2O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 525.3ºC | |
| Name | Acetamide, 2-[[1,2-dihydro-5,6,17,19,21-pentahydroxy-23-methoxy-2,4,12,16,18,20,22-heptamethyl-1,11-dioxo-2,7-(epoxypentadeca[1,11,13]trienimino)naphtho[2,1-b]furan-9-yl]oxy]-N,N-diisobutyl-, 21-acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 945ºC at 760mmHg |
| Molecular Formula | C47H66N2O13 |
| Molecular Weight | 867.03300 |
| Flash Point | 525.3ºC |
| Exact Mass | 866.45600 |
| PSA | 210.62000 |
| LogP | 6.70590 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | MKESTUWPTLCKOK-LPXJNVAJSA-N |
| SMILES | COC1C=COC2(C)Oc3c(C)c(O)c4c(O)c(cc(OCC(=O)N(CC(C)C)CC(C)C)c4c3C2=O)NC(=O)C(C)=CC=CC(C)C(O)C(C)C(O)C(C)C(OC(C)=O)C1C |
|
~%
Rifamycin,4-O-[... CAS#:16784-05-7 |
| Literature: Sensi,P. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 596 - 602 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Rifamycin-B-diisobutylamid |
| O4-(diisobutylcarbamoyl-methyl)-rifamycin |
| 4-O-[(N,N-Diisobutylcarbamoyl)methyl]rifamycin |
| rifamycin-B diisobutylamide |