4-O-[2-(Methylpropylamino)-2-oxoethyl]rifamycin structure
|
Common Name | 4-O-[2-(Methylpropylamino)-2-oxoethyl]rifamycin | ||
|---|---|---|---|---|
| CAS Number | 16784-10-4 | Molecular Weight | 810.92600 | |
| Density | 1.3g/cm3 | Boiling Point | 927.4ºC at 760 mmHg | |
| Molecular Formula | C43H58N2O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 514.7ºC | |
| Name | Rifamycin B methylpropylamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 927.4ºC at 760 mmHg |
| Molecular Formula | C43H58N2O13 |
| Molecular Weight | 810.92600 |
| Flash Point | 514.7ºC |
| Exact Mass | 810.39400 |
| PSA | 214.11000 |
| LogP | 5.38080 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | RCRKUTFIUCSOQL-UCYGXLJSSA-N |
| SMILES | CCCN(C)C(=O)COc1cc2c(O)c3c(O)c(C)c4c(c13)C(=O)C(C)(OC=CC(OC)C(C)C(OC(C)=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)C(=O)N2)O4 |
|
~%
4-O-[2-(Methylp... CAS#:16784-10-4 |
| Literature: Sensi,P. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 596 - 602 |
| Acetamide,2-((1,2-dihydro-5,6,17,19,21-pentahydroxy-23-methoxy-2,4,12,16,18,20,22-heptamethyl-1,11-dioxo-2,7-(epoxypentadeca(1,11,13)trienimino)naphtho(2,1-b)furan-9-yl)oxy)-N-methyl-N-propyl-,21-acetate |
| rifamycin-B methyl-propyl-amide |
| Rifamycin-B-<methyl-propyl-amid> |
| Rifamycin,4-O-(2-(methylpropylamino)-2-oxoethyl) |
| O4-[(methyl-propyl-carbamoyl)-methyl]-rifamycin |
| NCI 143-427 |
| yl-N-propyl |
| Rifamycin,4-O-(2-(methylpropylamino)-2-oxoethyl)-(9CI) |