TASIN-1 Hydrochloride structure
|
Common Name | TASIN-1 Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1678515-13-3 | Molecular Weight | 388.953 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H29ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TASIN-1 HydrochlorideTASIN-1 Hydrochloride is a truncated APC selective inhibitor. It acts by selectively killing colorectal cancer cells that express truncated APC by reducing cellular cholesterol levels and inducing apoptotic cell death through the ER stress/ROS/JNK signaling in colon cancer cells. |
| Name | TASIN-1 hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H29ClN2O3S |
|---|---|
| Molecular Weight | 388.953 |
| Exact Mass | 388.158752 |
| InChIKey | TXDTUQPRRXNCLP-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(N3CCC(C)CC3)CC2)cc1.Cl |
| TASIN-1 hydrochloride |
| Truncated APC Selective INhibitor-1 |
| 1,4'-Bipiperidine, 1'-[(4-methoxyphenyl)sulfonyl]-4-methyl-, hydrochloride |
| 1'-(4-Methoxyphenylsulfonyl)-4-methyl-1,4'-bipiperidine hydrochloride |
| 1,4'-Bipiperidine, 1'-[(4-methoxyphenyl)sulfonyl]-4-methyl-, hydrochloride (1:1) |
| 1'-[(4-Methoxyphenyl)sulfonyl]-4-methyl-1,4'-bipiperidine hydrochloride (1:1) |