1,2,3,4,5-pentamethyl-5-propan-2-ylcyclopenta-1,3-diene structure
|
Common Name | 1,2,3,4,5-pentamethyl-5-propan-2-ylcyclopenta-1,3-diene | ||
|---|---|---|---|---|
| CAS Number | 167904-46-3 | Molecular Weight | 178.31400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,3,4,5-pentamethyl-5-propan-2-ylcyclopenta-1,3-diene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H22 |
|---|---|
| Molecular Weight | 178.31400 |
| Exact Mass | 178.17200 |
| LogP | 4.33510 |
| InChIKey | AOXLYEXXOOTXIM-UHFFFAOYSA-N |
| SMILES | CC1=C(C)C(C)(C(C)C)C(C)=C1C |
|
~91%
1,2,3,4,5-penta... CAS#:167904-46-3 |
| Literature: Adam, Waldemar; Jacob, Ulrike; Prein, Michael Journal of the Chemical Society, Chemical Communications, 1995 , # 8 p. 839 - 840 |
| 1,3-Cyclopentadiene,1,2,3,4,5-pentamethyl-5-(1-methylethyl) |