Mearnsetin structure
|
Common Name | Mearnsetin | ||
|---|---|---|---|---|
| CAS Number | 16805-10-0 | Molecular Weight | 332.262 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 699.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C16H12O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.6±25.0 °C | |
| Name | 2-(3,5-dihydroxy-4-methoxyphenyl)-3,5,7-trihydroxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 699.4±55.0 °C at 760 mmHg |
| Molecular Formula | C16H12O8 |
| Molecular Weight | 332.262 |
| Flash Point | 264.6±25.0 °C |
| Exact Mass | 332.053223 |
| PSA | 140.59000 |
| LogP | 2.11 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.773 |
| InChIKey | HKEQVXVLTOSXLQ-UHFFFAOYSA-N |
| SMILES | COc1c(O)cc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc1O |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-(3,5-Dihydroxy-4-methoxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one |
| 4H-1-Benzopyran-4-one, 2-(3,5-dihydroxy-4-methoxyphenyl)-3,5,7-trihydroxy- |
| Mearnsetin |
| 4'methylmyricetin |