Bufa-20,22-dienolide,3,5-bis(acetyloxy)-14-hydroxy-19-oxo-, (3b,5b)- (9CI) structure
|
Common Name | Bufa-20,22-dienolide,3,5-bis(acetyloxy)-14-hydroxy-19-oxo-, (3b,5b)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 16808-82-5 | Molecular Weight | 500.58100 | |
| Density | 1.29g/cm3 | Boiling Point | 627.1ºC at 760mmHg | |
| Molecular Formula | C28H36O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.6ºC | |
| Name | 5.β.-Bufa-20,22-dienolide, 3.β.,5,14-trihydroxy-19-oxo-, 3,5-diacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 627.1ºC at 760mmHg |
| Molecular Formula | C28H36O8 |
| Molecular Weight | 500.58100 |
| Flash Point | 203.6ºC |
| Exact Mass | 500.24100 |
| PSA | 120.11000 |
| LogP | 3.67740 |
| Vapour Pressure | 2.34E-18mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | CCZLIPXVLKAJFW-GBGREZBSSA-N |
| SMILES | CC(=O)OC1CCC2(C=O)C3CCC4(C)C(c5ccc(=O)oc5)CCC4(O)C3CCC2(OC(C)=O)C1 |
| Hellebrigenin-diacetat |
| helium*benzene |
| Helium,compd. with benzene (1:1) |