Biurea,1,3,6-trimethyl-1,6-dinitroso- (8CI) structure
|
Common Name | Biurea,1,3,6-trimethyl-1,6-dinitroso- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 16813-39-1 | Molecular Weight | 218.17100 | |
| Density | 1.49g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H10N6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3,6-Trimethyl-1,6-dinitrosobiurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Molecular Formula | C5H10N6O4 |
| Molecular Weight | 218.17100 |
| Exact Mass | 218.07600 |
| PSA | 114.75000 |
| LogP | 0.28010 |
| Index of Refraction | 1.591 |
| InChIKey | GUGIXTAIEPOASJ-UHFFFAOYSA-N |
| SMILES | CN(N=O)C(=O)NN(C)C(=O)N(C)N=O |
|
~%
Biurea,1,3,6-tr... CAS#:16813-39-1 |
| Literature: Johnston; Opliger Journal of medicinal chemistry, 1967 , vol. 10, # 4 p. 675 - 681 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Naphthalenecarboxaldehyde,1,3,6-trimethoxy |