1-chloro-4-(1,3,4,4-tetrachloro-2-nitrobuta-1,3-dienyl)sulfanylbenzene structure
|
Common Name | 1-chloro-4-(1,3,4,4-tetrachloro-2-nitrobuta-1,3-dienyl)sulfanylbenzene | ||
|---|---|---|---|---|
| CAS Number | 168139-92-2 | Molecular Weight | 379.47400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H4Cl5NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-4-(1,3,4,4-tetrachloro-2-nitrobuta-1,3-dienyl)sulfanylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H4Cl5NO2S |
|---|---|
| Molecular Weight | 379.47400 |
| Exact Mass | 376.84100 |
| PSA | 71.12000 |
| LogP | 6.52540 |
| InChIKey | ZYVSYVPDEBELSO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C(=C(Cl)Sc1ccc(Cl)cc1)C(Cl)=C(Cl)Cl |
|
~78%
1-chloro-4-(1,3... CAS#:168139-92-2 |
| Literature: Ibis, Cemil; Goekmen, Zeliha; Bozkurt, Nihal Yilmaz Phosphorus, Sulfur and Silicon and the Related Elements, 2002 , vol. 177, # 12 p. 2907 - 2914 |
| Benzene,1-chloro-4-[(1,3,4,4-tetrachloro-2-nitro-1,3-butadienyl)thio] |
| 1,3,4,4-tetrachloro-1-(p-chlorophenylthio)-2-nitro-1,3-butadiene |
| 2-nitro-1,3,4,4-tetrachlor-mono(4-chlorphenylthio)-1,3-butadien |