N-Acetyl-S-(2-cyanoethyl)-L-cysteine structure
|
Common Name | N-Acetyl-S-(2-cyanoethyl)-L-cysteine | ||
|---|---|---|---|---|
| CAS Number | 168208-30-8 | Molecular Weight | 233.29 | |
| Density | ~1.3 g/cm3(Predicted) | Boiling Point | ~543.8° C at 760 mmHg (Predicted) | |
| Molecular Formula | C8H15N3O3S | Melting Point | 102-104° C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-Acetyl-S-(2-cyanoethyl)-L-cysteine |
|---|---|
| Synonym | More Synonyms |
| Density | ~1.3 g/cm3(Predicted) |
|---|---|
| Boiling Point | ~543.8° C at 760 mmHg (Predicted) |
| Melting Point | 102-104° C |
| Molecular Formula | C8H15N3O3S |
| Molecular Weight | 233.29 |
| Exact Mass | 233.083405 |
| Index of Refraction | n20D1.53 (Predicted) |
| InChIKey | ARTXYBVDCHAPSC-FJXQXJEOSA-N |
| SMILES | CC(=O)NC(CSCCC#N)C(=O)[O-].[NH4+] |
| Water Solubility | Soluble in dimethyl sulfoxide, methanol, and water. |
| Ammonium (2R)-2-acetamido-3-[(2-cyanoethyl)sulfanyl]propanoate |
| L-Cysteine, N-acetyl-S-(2-cyanoethyl)-, ammonium salt |
| N-Acetyl-S-(2-cyanoethyl)cysteine Ammonium Salt |
| S-(2-Cyanoethyl)mercapturic Acid Ammonium Salt |