bis(4-methylphenyl)-phenyl-sulfanylidene-λ5-phosphane structure
|
Common Name | bis(4-methylphenyl)-phenyl-sulfanylidene-λ5-phosphane | ||
|---|---|---|---|---|
| CAS Number | 16822-31-4 | Molecular Weight | 322.40400 | |
| Density | 1.169g/cm3 | Boiling Point | 450.821ºC at 760 mmHg | |
| Molecular Formula | C20H19PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.448ºC | |
| Name | bis(4-methylphenyl)-phenyl-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 450.821ºC at 760 mmHg |
| Molecular Formula | C20H19PS |
| Molecular Weight | 322.40400 |
| Flash Point | 226.448ºC |
| Exact Mass | 322.09500 |
| PSA | 41.90000 |
| LogP | 4.70980 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | HBTVPYKDOWMLIA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(P(=S)(c2ccccc2)c2ccc(C)cc2)cc1 |
|
~%
bis(4-methylphe... CAS#:16822-31-4 |
| Literature: Morgan; Herr Journal of the American Chemical Society, 1952 , vol. 74, p. 4526,4529 |
| Phosphine sulfide,bis(4-methylphenyl)phenyl |
| Phenyl-di-p-tolyl-thiophosphinoxid |
| bis(4-methylphenyl)phenylphosphine sulfide |
| phenyl-di-p-tolyl-phosphine sulfide |
| di(p-tolyl)phenylphosphine sulfide |
| Phenyl-di-p-tolyl-phosphinsulfid |